{
  "$schema": "https://foodadditiveindex.com/api/v1/schema.json",
  "id": "https://foodadditiveindex.com/additives/tributyrin",
  "slug": "tributyrin",
  "name": "Tributyrin",
  "identifiers": {
    "e_number": null,
    "ins_number": null,
    "cas_number": "60-01-5",
    "inchikey": "UYXTWWCETRIEDR-UHFFFAOYSA-N",
    "pubchem_cid": 6050
  },
  "functional_class": null,
  "summary": "Tributyrin is a flavouring that releases butyric acid, the compound behind the taste of butter and, in quantity, of vomit — which is why the dose matters so much.",
  "derivation_summary": "Made by reacting glycerol with butyric acid. It occurs naturally in butter.",
  "regulatory_status": [
    {
      "jurisdiction": "US",
      "jurisdiction_name": "United States",
      "authority": "Food and Drug Administration",
      "status": "permitted",
      "status_label": "Permitted",
      "provision_count": 1,
      "provisions": [
        {
          "status": "permitted",
          "food_category": null,
          "max_level": null,
          "max_level_unit": null,
          "conditions": null,
          "effective_from": null,
          "citation": {
            "ref": "21 CFR 184.1903",
            "url": "https://www.ecfr.gov/current/title-21/section-184.1903"
          },
          "source": "ecfr",
          "retrieved_at": "2026-09-07T18:25:51.549Z"
        }
      ]
    },
    {
      "jurisdiction": "CODEX",
      "jurisdiction_name": "Codex Alimentarius",
      "authority": "Codex Alimentarius Commission / JECFA",
      "status": "not_listed",
      "status_label": "Not listed",
      "note": "Does not appear on this jurisdiction’s permitted list. That is not the same as being prohibited.",
      "provision_count": 0,
      "provisions": []
    }
  ],
  "names": [
    {
      "name": "60-01-5",
      "type": "cas",
      "source": "ecfr"
    },
    {
      "name": "1,2,3-Propanetriol, tributyrate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "1,2,3-Propanetriyl tributanoate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "1,2,3-tributanoylglycerol",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "1,2,3-Tributyrylglycerol",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "1,3-bis(butanoyloxy)propan-2-yl butanoate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "1,3-Tributyrylglycerol",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "2,3-Bis(butyryloxy)propyl butyrate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "2,3-Bis(butyryloxy)propyl butyrate #",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "2,3-di(butanoyloxy)propyl butanoate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "4-02-00-00799 (Beilstein Handbook Reference)",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "BRN 1714746",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Butanoic acid, 1,2,3-propanetriyl ester",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Butyric acid triester with glycerin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Butyrin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Butyrin, tri-",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Butyryl triglyceride",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "CAS-60-01-5",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "FEMA 2223",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "FEMA No. 2223",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glycerin tributyrate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glycerol tributanoate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glycerol tributyrate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glyceroltributyrin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glycery tributyrate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "GLYCERYL TRI-BUTYRATE",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glyceryl tributyrate",
      "type": "common",
      "source": "openfoodtox"
    },
    {
      "name": "Glyceryl tributyrate, >=99%",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glyceryl tributyrate, analytical standard",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glyceryl tributyrate, puriss., >=98.5% (GC)",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Glyceryl tributyrate, technical, >=94.0% (GC)",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "HSDB 878",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Kodaflex",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Kodaflex tripropionin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "propane-1,2,3-triyl tributanoate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Propane-1,2,3-triyl tributyrate",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "tri-butyrin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Tri-n-butyrin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Tributin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "TRIBUTYRIN",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Tributyrin, 97%, FG",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Tributyrinine",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Tributyrl glyceride",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Tributyroin",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "Tributyryl glyceride",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "tributyrylglycerol",
      "type": "common",
      "source": "pubchem"
    },
    {
      "name": "2,3-Di(butanoyloxy)propyl butanoate",
      "type": "iupac",
      "source": "openfoodtox"
    },
    {
      "name": "InChI=1/C15H26O6/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H",
      "type": "iupac",
      "source": "pubchem"
    },
    {
      "name": "Tributyrin",
      "type": "label",
      "source": "ecfr"
    }
  ],
  "hazard_reference_values": [],
  "sources": [
    {
      "key": "ecfr",
      "name": "Electronic Code of Federal Regulations, Title 21",
      "publisher": "U.S. Government Publishing Office / National Archives",
      "licence": "Public domain",
      "url": "https://www.ecfr.gov/api/versioner/v1/full/2026-08-31/title-21.xml",
      "retrieved_at": "2026-09-07T18:25:51.549Z"
    }
  ],
  "citation_policy": "Cite as: Food Additive Index, \"Tributyrin\", https://foodadditiveindex.com/additives/tributyrin. This site reports regulatory status and does not rate additives.",
  "generated_at": "2026-09-08T00:09:38.753Z"
}